C12H17N7S — CID 103062028
[5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanylmethyl)pyrazin-2-yl]hydrazine (PubChem CID 103062028) has the molecular formula C12H17N7S and a molecular weight of 291.38 g/mol. Its IUPAC name is [5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanylmethyl)pyrazin-2-yl]hydrazine.
| Compound Name | [5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanylmethyl)pyrazin-2-yl]hydrazine |
|---|---|
| PubChem CID | 103062028 |
| Molecular Formula | C12H17N7S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | [5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanylmethyl)pyrazin-2-yl]hydrazine |
| SMILES | NNc1cnc(CSc2nnc3n2CCCCC3)cn1 |
| InChI | InChI=1S/C12H17N7S/c13-16-10-7-14-9(6-15-10)8-20-12-18-17-11-4-2-1-3-5-19(11)12/h6-7H,1-5,8,13H2,(H,15,16) |
| InChIKey | COYLHOAUVFJZGK-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|