C11H15N7S — CID 80930452
[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)pyrimidin-2-yl]hydrazine (PubChem CID 80930452) has the molecular formula C11H15N7S and a molecular weight of 277.36 g/mol. Its IUPAC name is [4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)pyrimidin-2-yl]hydrazine.
| Compound Name | [4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)pyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 80930452 |
| Molecular Formula | C11H15N7S |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | [4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)pyrimidin-2-yl]hydrazine |
| SMILES | NNc1nccc(Sc2nnc3n2CCCCC3)n1 |
| InChI | InChI=1S/C11H15N7S/c12-15-10-13-6-5-9(14-10)19-11-17-16-8-4-2-1-3-7-18(8)11/h5-6H,1-4,7,12H2,(H,13,14,15) |
| InChIKey | GJXMMKPTWGGVBA-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|