C6H8N8S — CID 80922093
[4-(1-methyltetrazol-5-yl)sulfanylpyrimidin-2-yl]hydrazine (PubChem CID 80922093) has the molecular formula C6H8N8S and a molecular weight of 224.25 g/mol. Its IUPAC name is [4-(1-methyltetrazol-5-yl)sulfanylpyrimidin-2-yl]hydrazine.
| Compound Name | [4-(1-methyltetrazol-5-yl)sulfanylpyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 80922093 |
| Molecular Formula | C6H8N8S |
| Molecular Weight | 224.25 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | [4-(1-methyltetrazol-5-yl)sulfanylpyrimidin-2-yl]hydrazine |
| SMILES | Cn1nnnc1Sc1ccnc(NN)n1 |
| InChI | InChI=1S/C6H8N8S/c1-14-6(11-12-13-14)15-4-2-3-8-5(9-4)10-7/h2-3H,7H2,1H3,(H,8,9,10) |
| InChIKey | FJXUGMIWVZOBEO-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 107.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.25 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|