C11H13ClN6S — CID 47151384
4-chloro-6-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)pyrimidin-2-amine (PubChem CID 47151384) has the molecular formula C11H13ClN6S and a molecular weight of 296.79 g/mol. Its IUPAC name is 4-chloro-6-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)pyrimidin-2-amine.
| Compound Name | 4-chloro-6-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 47151384 |
| Molecular Formula | C11H13ClN6S |
| Molecular Weight | 296.79 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 4-chloro-6-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)pyrimidin-2-amine |
| SMILES | Nc1nc(Cl)cc(Sc2nnc3n2CCCCC3)n1 |
| InChI | InChI=1S/C11H13ClN6S/c12-7-6-9(15-10(13)14-7)19-11-17-16-8-4-2-1-3-5-18(8)11/h6H,1-5H2,(H2,13,14,15) |
| InChIKey | ZQVCXDNNLQGYTB-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.79 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |