C14H16ClN5S — CID 62947381
2-chloro-4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)benzenecarboximidamide (PubChem CID 62947381) has the molecular formula C14H16ClN5S and a molecular weight of 321.84 g/mol. Its IUPAC name is 2-chloro-4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)benzenecarboximidamide.
| Compound Name | 2-chloro-4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 62947381 |
| Molecular Formula | C14H16ClN5S |
| Molecular Weight | 321.84 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 2-chloro-4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(Sc2nnc3n2CCCCC3)cc1Cl |
| InChI | InChI=1S/C14H16ClN5S/c15-11-8-9(5-6-10(11)13(16)17)21-14-19-18-12-4-2-1-3-7-20(12)14/h5-6,8H,1-4,7H2,(H3,16,17) |
| InChIKey | HORJOGAPOBGFPH-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.84 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|