C15H17N3O2S — CID 62703123
4-methyl-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)benzoic acid (PubChem CID 62703123) has the molecular formula C15H17N3O2S and a molecular weight of 303.39 g/mol. Its IUPAC name is 4-methyl-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)benzoic acid.
| Compound Name | 4-methyl-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)benzoic acid |
|---|---|
| PubChem CID | 62703123 |
| Molecular Formula | C15H17N3O2S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 4-methyl-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)benzoic acid |
| SMILES | Cc1ccc(C(=O)O)c(Sc2nnc3n2CCCCC3)c1 |
| InChI | InChI=1S/C15H17N3O2S/c1-10-6-7-11(14(19)20)12(9-10)21-15-17-16-13-5-3-2-4-8-18(13)15/h6-7,9H,2-5,8H2,1H3,(H,19,20) |
| InChIKey | PFBWJAYUWFRIEZ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |