C13H15N5O2S — CID 80869993
2-nitro-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)aniline (PubChem CID 80869993) has the molecular formula C13H15N5O2S and a molecular weight of 305.36 g/mol. Its IUPAC name is 2-nitro-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)aniline.
| Compound Name | 2-nitro-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)aniline |
|---|---|
| PubChem CID | 80869993 |
| Molecular Formula | C13H15N5O2S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 2-nitro-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)aniline |
| SMILES | Nc1cccc(Sc2nnc3n2CCCCC3)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H15N5O2S/c14-9-5-4-6-10(12(9)18(19)20)21-13-16-15-11-7-2-1-3-8-17(11)13/h4-6H,1-3,7-8,14H2 |
| InChIKey | JKYXUPRPTDXCDS-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|