C15H19ClN4S — CID 114864086
1-[4-chloro-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)phenyl]-N-methylmethanamine (PubChem CID 114864086) has the molecular formula C15H19ClN4S and a molecular weight of 322.87 g/mol. Its IUPAC name is 1-[4-chloro-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)phenyl]-N-methylmethanamine.
| Compound Name | 1-[4-chloro-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)phenyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 114864086 |
| Molecular Formula | C15H19ClN4S |
| Molecular Weight | 322.87 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 1-[4-chloro-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)phenyl]-N-methylmethanamine |
| SMILES | CNCc1ccc(Cl)cc1Sc1nnc2n1CCCCC2 |
| InChI | InChI=1S/C15H19ClN4S/c1-17-10-11-6-7-12(16)9-13(11)21-15-19-18-14-5-3-2-4-8-20(14)15/h6-7,9,17H,2-5,8,10H2,1H3 |
| InChIKey | PCSNXLIGPKSQEK-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.87 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |