C15H16N4OS2 — CID 30386707
2-(furan-2-yl)-4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanylmethyl)-1,3-thiazole (PubChem CID 30386707) has the molecular formula C15H16N4OS2 and a molecular weight of 332.45 g/mol. Its IUPAC name is 2-(furan-2-yl)-4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanylmethyl)-1,3-thiazole.
| Compound Name | 2-(furan-2-yl)-4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanylmethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 30386707 |
| Molecular Formula | C15H16N4OS2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 2-(furan-2-yl)-4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanylmethyl)-1,3-thiazole |
| SMILES | c1coc(-c2nc(CSc3nnc4n3CCCCC4)cs2)c1 |
| InChI | InChI=1S/C15H16N4OS2/c1-2-6-13-17-18-15(19(13)7-3-1)22-10-11-9-21-14(16-11)12-5-4-8-20-12/h4-5,8-9H,1-3,6-7,10H2 |
| InChIKey | HZFACXIWRANZCU-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |