C11H19NOS — CID 79249026
(2S)-3-methyl-2-(2-thiophen-3-ylethylamino)butan-1-ol (PubChem CID 79249026) has the molecular formula C11H19NOS and a molecular weight of 213.35 g/mol. Its IUPAC name is (2S)-3-methyl-2-(2-thiophen-3-ylethylamino)butan-1-ol.
| Compound Name | (2S)-3-methyl-2-(2-thiophen-3-ylethylamino)butan-1-ol |
|---|---|
| PubChem CID | 79249026 |
| Molecular Formula | C11H19NOS |
| Molecular Weight | 213.35 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | (2S)-3-methyl-2-(2-thiophen-3-ylethylamino)butan-1-ol |
| SMILES | CC(C)[C@@H](CO)NCCc1ccsc1 |
| InChI | InChI=1S/C11H19NOS/c1-9(2)11(7-13)12-5-3-10-4-6-14-8-10/h4,6,8-9,11-13H,3,5,7H2,1-2H3/t11-/m1/s1 |
| InChIKey | IBDCEPKBEFGUQX-LLVKDONJSA-N |
| XLogP | 1.90 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.35 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |