C11H12F3NOS — CID 71411756
2,2,2-trifluoro-N-[2-(4-methylphenyl)sulfanylethyl]acetamide (PubChem CID 71411756) has the molecular formula C11H12F3NOS and a molecular weight of 263.28 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[2-(4-methylphenyl)sulfanylethyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[2-(4-methylphenyl)sulfanylethyl]acetamide |
|---|---|
| PubChem CID | 71411756 |
| Molecular Formula | C11H12F3NOS |
| Molecular Weight | 263.28 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 2,2,2-trifluoro-N-[2-(4-methylphenyl)sulfanylethyl]acetamide |
| SMILES | Cc1ccc(SCCNC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H12F3NOS/c1-8-2-4-9(5-3-8)17-7-6-15-10(16)11(12,13)14/h2-5H,6-7H2,1H3,(H,15,16) |
| InChIKey | CBNUDLPFAXGAFZ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.28 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|