C14H17Cl2NOS — CID 46474945
2,2-dichloro-1-methyl-N-[2-(4-methylphenyl)sulfanylethyl]cyclopropane-1-carboxamide (PubChem CID 46474945) has the molecular formula C14H17Cl2NOS and a molecular weight of 318.27 g/mol. Its IUPAC name is 2,2-dichloro-1-methyl-N-[2-(4-methylphenyl)sulfanylethyl]cyclopropane-1-carboxamide.
| Compound Name | 2,2-dichloro-1-methyl-N-[2-(4-methylphenyl)sulfanylethyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 46474945 |
| Molecular Formula | C14H17Cl2NOS |
| Molecular Weight | 318.27 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 2,2-dichloro-1-methyl-N-[2-(4-methylphenyl)sulfanylethyl]cyclopropane-1-carboxamide |
| SMILES | Cc1ccc(SCCNC(=O)C2(C)CC2(Cl)Cl)cc1 |
| InChI | InChI=1S/C14H17Cl2NOS/c1-10-3-5-11(6-4-10)19-8-7-17-12(18)13(2)9-14(13,15)16/h3-6H,7-9H2,1-2H3,(H,17,18) |
| InChIKey | FDOIYWWDPXTTCD-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.27 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|