C13H19N3O2S — CID 32710807
(2S)-2-(carbamoylamino)-N-[2-(4-methylphenyl)sulfanylethyl]propanamide (PubChem CID 32710807) has the molecular formula C13H19N3O2S and a molecular weight of 281.38 g/mol. Its IUPAC name is (2S)-2-(carbamoylamino)-N-[2-(4-methylphenyl)sulfanylethyl]propanamide.
| Compound Name | (2S)-2-(carbamoylamino)-N-[2-(4-methylphenyl)sulfanylethyl]propanamide |
|---|---|
| PubChem CID | 32710807 |
| Molecular Formula | C13H19N3O2S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | (2S)-2-(carbamoylamino)-N-[2-(4-methylphenyl)sulfanylethyl]propanamide |
| SMILES | Cc1ccc(SCCNC(=O)[C@H](C)NC(N)=O)cc1 |
| InChI | InChI=1S/C13H19N3O2S/c1-9-3-5-11(6-4-9)19-8-7-15-12(17)10(2)16-13(14)18/h3-6,10H,7-8H2,1-2H3,(H,15,17)(H3,14,16,18)/t10-/m0/s1 |
| InChIKey | POSONVNWFKGNIU-JTQLQIEISA-N |
| XLogP | 1.26 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|