C17H24F3NO2S — CID 89209554
2,2,2-trifluoro-N-[2-[3-(4-hydroxyheptan-4-yl)phenyl]sulfanylethyl]acetamide (PubChem CID 89209554) has the molecular formula C17H24F3NO2S and a molecular weight of 363.45 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[2-[3-(4-hydroxyheptan-4-yl)phenyl]sulfanylethyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[2-[3-(4-hydroxyheptan-4-yl)phenyl]sulfanylethyl]acetamide |
|---|---|
| PubChem CID | 89209554 |
| Molecular Formula | C17H24F3NO2S |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | 2,2,2-trifluoro-N-[2-[3-(4-hydroxyheptan-4-yl)phenyl]sulfanylethyl]acetamide |
| SMILES | CCCC(O)(CCC)c1cccc(SCCNC(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C17H24F3NO2S/c1-3-8-16(23,9-4-2)13-6-5-7-14(12-13)24-11-10-21-15(22)17(18,19)20/h5-7,12,23H,3-4,8-11H2,1-2H3,(H,21,22) |
| InChIKey | XUTKKYCERZVAHD-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|