C10H12O4S2 — CID 60917284
4-(2-methylsulfonylethylsulfanyl)benzoic acid (PubChem CID 60917284) has the molecular formula C10H12O4S2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 4-(2-methylsulfonylethylsulfanyl)benzoic acid.
| Compound Name | 4-(2-methylsulfonylethylsulfanyl)benzoic acid |
|---|---|
| PubChem CID | 60917284 |
| Molecular Formula | C10H12O4S2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.02 |
| IUPAC Name | 4-(2-methylsulfonylethylsulfanyl)benzoic acid |
| SMILES | CS(=O)(=O)CCSc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C10H12O4S2/c1-16(13,14)7-6-15-9-4-2-8(3-5-9)10(11)12/h2-5H,6-7H2,1H3,(H,11,12) |
| InChIKey | XDJJPMJOZZORCZ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |