C18H14O8S2 — CID 21273771
4-[2-(3,4-dicarboxyphenyl)sulfanylethylsulfanyl]phthalic acid (PubChem CID 21273771) has the molecular formula C18H14O8S2 and a molecular weight of 422.44 g/mol. Its IUPAC name is 4-[2-(3,4-dicarboxyphenyl)sulfanylethylsulfanyl]phthalic acid.
| Compound Name | 4-[2-(3,4-dicarboxyphenyl)sulfanylethylsulfanyl]phthalic acid |
|---|---|
| PubChem CID | 21273771 |
| Molecular Formula | C18H14O8S2 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.01 |
| IUPAC Name | 4-[2-(3,4-dicarboxyphenyl)sulfanylethylsulfanyl]phthalic acid |
| SMILES | O=C(O)c1ccc(SCCSc2ccc(C(=O)O)c(C(=O)O)c2)cc1C(=O)O |
| InChI | InChI=1S/C18H14O8S2/c19-15(20)11-3-1-9(7-13(11)17(23)24)27-5-6-28-10-2-4-12(16(21)22)14(8-10)18(25)26/h1-4,7-8H,5-6H2,(H,19,20)(H,21,22)(H,23,24)(H,25,26) |
| InChIKey | NISGQJWEYNBUDZ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|