C16H14O8S — CID 175195962
4-(3,4-dicarboxyphenyl)sulfanylphthalic acid;molecular hydrogen (PubChem CID 175195962) has the molecular formula C16H14O8S and a molecular weight of 366.35 g/mol. Its IUPAC name is 4-(3,4-dicarboxyphenyl)sulfanylphthalic acid;molecular hydrogen.
| Compound Name | 4-(3,4-dicarboxyphenyl)sulfanylphthalic acid;molecular hydrogen |
|---|---|
| PubChem CID | 175195962 |
| Molecular Formula | C16H14O8S |
| Molecular Weight | 366.35 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | 4-(3,4-dicarboxyphenyl)sulfanylphthalic acid;molecular hydrogen |
| SMILES | O=C(O)c1ccc(Sc2ccc(C(=O)O)c(C(=O)O)c2)cc1C(=O)O.[H][H].[H][H] |
| InChI | InChI=1S/C16H10O8S.2H2/c17-13(18)9-3-1-7(5-11(9)15(21)22)25-8-2-4-10(14(19)20)12(6-8)16(23)24;;/h1-6H,(H,17,18)(H,19,20)(H,21,22)(H,23,24);2*1H |
| InChIKey | JPWJPEKFZHZAHX-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.35 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |