C28H18O9S2 — CID 21434752
3-[4-[4-(3,4-dicarboxyphenyl)sulfanylphenoxy]phenyl]sulfanylphthalic acid (PubChem CID 21434752) has the molecular formula C28H18O9S2 and a molecular weight of 562.58 g/mol. Its IUPAC name is 3-[4-[4-(3,4-dicarboxyphenyl)sulfanylphenoxy]phenyl]sulfanylphthalic acid.
| Compound Name | 3-[4-[4-(3,4-dicarboxyphenyl)sulfanylphenoxy]phenyl]sulfanylphthalic acid |
|---|---|
| PubChem CID | 21434752 |
| Molecular Formula | C28H18O9S2 |
| Molecular Weight | 562.58 g/mol |
| Exact Mass | 562.04 |
| IUPAC Name | 3-[4-[4-(3,4-dicarboxyphenyl)sulfanylphenoxy]phenyl]sulfanylphthalic acid |
| SMILES | O=C(O)c1ccc(Sc2ccc(Oc3ccc(Sc4cccc(C(=O)O)c4C(=O)O)cc3)cc2)cc1C(=O)O |
| InChI | InChI=1S/C28H18O9S2/c29-25(30)20-13-12-19(14-22(20)27(33)34)38-17-8-4-15(5-9-17)37-16-6-10-18(11-7-16)39-23-3-1-2-21(26(31)32)24(23)28(35)36/h1-14H,(H,29,30)(H,31,32)(H,33,34)(H,35,36) |
| InChIKey | OZEYIKZSIQKPLK-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 158.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.58 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |