C17H17BrO2S — CID 114332962
2-bromo-5-(4-phenylbutylsulfanyl)benzoic acid (PubChem CID 114332962) has the molecular formula C17H17BrO2S and a molecular weight of 365.29 g/mol. Its IUPAC name is 2-bromo-5-(4-phenylbutylsulfanyl)benzoic acid.
| Compound Name | 2-bromo-5-(4-phenylbutylsulfanyl)benzoic acid |
|---|---|
| PubChem CID | 114332962 |
| Molecular Formula | C17H17BrO2S |
| Molecular Weight | 365.29 g/mol |
| Exact Mass | 364.01 |
| IUPAC Name | 2-bromo-5-(4-phenylbutylsulfanyl)benzoic acid |
| SMILES | O=C(O)c1cc(SCCCCc2ccccc2)ccc1Br |
| InChI | InChI=1S/C17H17BrO2S/c18-16-10-9-14(12-15(16)17(19)20)21-11-5-4-8-13-6-2-1-3-7-13/h1-3,6-7,9-10,12H,4-5,8,11H2,(H,19,20) |
| InChIKey | RJVHJDNMNHUPKM-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.29 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|