C10H8BrF3O3S — CID 106704481
2-bromo-5-(2,2,2-trifluoroethoxymethylsulfanyl)benzoic acid (PubChem CID 106704481) has the molecular formula C10H8BrF3O3S and a molecular weight of 345.14 g/mol. Its IUPAC name is 2-bromo-5-(2,2,2-trifluoroethoxymethylsulfanyl)benzoic acid.
| Compound Name | 2-bromo-5-(2,2,2-trifluoroethoxymethylsulfanyl)benzoic acid |
|---|---|
| PubChem CID | 106704481 |
| Molecular Formula | C10H8BrF3O3S |
| Molecular Weight | 345.14 g/mol |
| Exact Mass | 343.93 |
| IUPAC Name | 2-bromo-5-(2,2,2-trifluoroethoxymethylsulfanyl)benzoic acid |
| SMILES | O=C(O)c1cc(SCOCC(F)(F)F)ccc1Br |
| InChI | InChI=1S/C10H8BrF3O3S/c11-8-2-1-6(3-7(8)9(15)16)18-5-17-4-10(12,13)14/h1-3H,4-5H2,(H,15,16) |
| InChIKey | YQIHGNOAPMIDNM-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.14 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|