C13H17BrO3S — CID 114491473
2-bromo-5-(2-ethyl-2-hydroxybutyl)sulfanylbenzoic acid (PubChem CID 114491473) has the molecular formula C13H17BrO3S and a molecular weight of 333.25 g/mol. Its IUPAC name is 2-bromo-5-(2-ethyl-2-hydroxybutyl)sulfanylbenzoic acid.
| Compound Name | 2-bromo-5-(2-ethyl-2-hydroxybutyl)sulfanylbenzoic acid |
|---|---|
| PubChem CID | 114491473 |
| Molecular Formula | C13H17BrO3S |
| Molecular Weight | 333.25 g/mol |
| Exact Mass | 332.01 |
| IUPAC Name | 2-bromo-5-(2-ethyl-2-hydroxybutyl)sulfanylbenzoic acid |
| SMILES | CCC(O)(CC)CSc1ccc(Br)c(C(=O)O)c1 |
| InChI | InChI=1S/C13H17BrO3S/c1-3-13(17,4-2)8-18-9-5-6-11(14)10(7-9)12(15)16/h5-7,17H,3-4,8H2,1-2H3,(H,15,16) |
| InChIKey | VVGDVCNQVBLKQY-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.25 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |