C12H12BrF3O4 — CID 63051967
3-bromo-4-[3-(2,2,2-trifluoroethoxy)propoxy]benzoic acid (PubChem CID 63051967) has the molecular formula C12H12BrF3O4 and a molecular weight of 357.12 g/mol. Its IUPAC name is 3-bromo-4-[3-(2,2,2-trifluoroethoxy)propoxy]benzoic acid.
| Compound Name | 3-bromo-4-[3-(2,2,2-trifluoroethoxy)propoxy]benzoic acid |
|---|---|
| PubChem CID | 63051967 |
| Molecular Formula | C12H12BrF3O4 |
| Molecular Weight | 357.12 g/mol |
| Exact Mass | 355.99 |
| IUPAC Name | 3-bromo-4-[3-(2,2,2-trifluoroethoxy)propoxy]benzoic acid |
| SMILES | O=C(O)c1ccc(OCCCOCC(F)(F)F)c(Br)c1 |
| InChI | InChI=1S/C12H12BrF3O4/c13-9-6-8(11(17)18)2-3-10(9)20-5-1-4-19-7-12(14,15)16/h2-3,6H,1,4-5,7H2,(H,17,18) |
| InChIKey | XZBFZAKUFBXAIR-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.12 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|