C12H12F3IO4 — CID 82995562
5-iodo-2-[3-(2,2,2-trifluoroethoxy)propoxy]benzoic acid (PubChem CID 82995562) has the molecular formula C12H12F3IO4 and a molecular weight of 404.12 g/mol. Its IUPAC name is 5-iodo-2-[3-(2,2,2-trifluoroethoxy)propoxy]benzoic acid.
| Compound Name | 5-iodo-2-[3-(2,2,2-trifluoroethoxy)propoxy]benzoic acid |
|---|---|
| PubChem CID | 82995562 |
| Molecular Formula | C12H12F3IO4 |
| Molecular Weight | 404.12 g/mol |
| Exact Mass | 403.97 |
| IUPAC Name | 5-iodo-2-[3-(2,2,2-trifluoroethoxy)propoxy]benzoic acid |
| SMILES | O=C(O)c1cc(I)ccc1OCCCOCC(F)(F)F |
| InChI | InChI=1S/C12H12F3IO4/c13-12(14,15)7-19-4-1-5-20-10-3-2-8(16)6-9(10)11(17)18/h2-3,6H,1,4-5,7H2,(H,17,18) |
| InChIKey | WROBUAWPIPPAEK-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.12 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|