C10H14N2O4S2 — CID 43617667
methyl 3-(2-amino-4-sulfamoylphenyl)sulfanylpropanoate (PubChem CID 43617667) has the molecular formula C10H14N2O4S2 and a molecular weight of 290.37 g/mol. Its IUPAC name is methyl 3-(2-amino-4-sulfamoylphenyl)sulfanylpropanoate.
| Compound Name | methyl 3-(2-amino-4-sulfamoylphenyl)sulfanylpropanoate |
|---|---|
| PubChem CID | 43617667 |
| Molecular Formula | C10H14N2O4S2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | methyl 3-(2-amino-4-sulfamoylphenyl)sulfanylpropanoate |
| SMILES | COC(=O)CCSc1ccc(S(N)(=O)=O)cc1N |
| InChI | InChI=1S/C10H14N2O4S2/c1-16-10(13)4-5-17-9-3-2-7(6-8(9)11)18(12,14)15/h2-3,6H,4-5,11H2,1H3,(H2,12,14,15) |
| InChIKey | KJYULGWRGXJROV-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 112.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|