C11H16N2O4S2 — CID 79904879
methyl 3-(5-amino-2-methyl-3-sulfamoylphenyl)sulfanylpropanoate (PubChem CID 79904879) has the molecular formula C11H16N2O4S2 and a molecular weight of 304.39 g/mol. Its IUPAC name is methyl 3-(5-amino-2-methyl-3-sulfamoylphenyl)sulfanylpropanoate.
| Compound Name | methyl 3-(5-amino-2-methyl-3-sulfamoylphenyl)sulfanylpropanoate |
|---|---|
| PubChem CID | 79904879 |
| Molecular Formula | C11H16N2O4S2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | methyl 3-(5-amino-2-methyl-3-sulfamoylphenyl)sulfanylpropanoate |
| SMILES | COC(=O)CCSc1cc(N)cc(S(N)(=O)=O)c1C |
| InChI | InChI=1S/C11H16N2O4S2/c1-7-9(18-4-3-11(14)17-2)5-8(12)6-10(7)19(13,15)16/h5-6H,3-4,12H2,1-2H3,(H2,13,15,16) |
| InChIKey | PMTFYQXPVSCSID-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 112.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|