C11H18N4O3S — CID 79896218
3-(5-amino-2-methyl-3-sulfamoylanilino)-N-methylpropanamide (PubChem CID 79896218) has the molecular formula C11H18N4O3S and a molecular weight of 286.36 g/mol. Its IUPAC name is 3-(5-amino-2-methyl-3-sulfamoylanilino)-N-methylpropanamide.
| Compound Name | 3-(5-amino-2-methyl-3-sulfamoylanilino)-N-methylpropanamide |
|---|---|
| PubChem CID | 79896218 |
| Molecular Formula | C11H18N4O3S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 3-(5-amino-2-methyl-3-sulfamoylanilino)-N-methylpropanamide |
| SMILES | CNC(=O)CCNc1cc(N)cc(S(N)(=O)=O)c1C |
| InChI | InChI=1S/C11H18N4O3S/c1-7-9(15-4-3-11(16)14-2)5-8(12)6-10(7)19(13,17)18/h5-6,15H,3-4,12H2,1-2H3,(H,14,16)(H2,13,17,18) |
| InChIKey | IDIKLRMOLYAUJN-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|