C10H17N3O3S — CID 79896644
5-amino-3-(2-hydroxypropylamino)-2-methylbenzenesulfonamide (PubChem CID 79896644) has the molecular formula C10H17N3O3S and a molecular weight of 259.33 g/mol. Its IUPAC name is 5-amino-3-(2-hydroxypropylamino)-2-methylbenzenesulfonamide.
| Compound Name | 5-amino-3-(2-hydroxypropylamino)-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 79896644 |
| Molecular Formula | C10H17N3O3S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 5-amino-3-(2-hydroxypropylamino)-2-methylbenzenesulfonamide |
| SMILES | Cc1c(NCC(C)O)cc(N)cc1S(N)(=O)=O |
| InChI | InChI=1S/C10H17N3O3S/c1-6(14)5-13-9-3-8(11)4-10(7(9)2)17(12,15)16/h3-4,6,13-14H,5,11H2,1-2H3,(H2,12,15,16) |
| InChIKey | OMXGIJYYRBBOBS-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|