C11H19N3O3S — CID 79896730
5-amino-3-(3-methoxypropylamino)-2-methylbenzenesulfonamide (PubChem CID 79896730) has the molecular formula C11H19N3O3S and a molecular weight of 273.36 g/mol. Its IUPAC name is 5-amino-3-(3-methoxypropylamino)-2-methylbenzenesulfonamide.
| Compound Name | 5-amino-3-(3-methoxypropylamino)-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 79896730 |
| Molecular Formula | C11H19N3O3S |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 5-amino-3-(3-methoxypropylamino)-2-methylbenzenesulfonamide |
| SMILES | COCCCNc1cc(N)cc(S(N)(=O)=O)c1C |
| InChI | InChI=1S/C11H19N3O3S/c1-8-10(14-4-3-5-17-2)6-9(12)7-11(8)18(13,15)16/h6-7,14H,3-5,12H2,1-2H3,(H2,13,15,16) |
| InChIKey | KWESRMHSCXELJU-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|