C13H20N2O4S3 — CID 19594489
3-cyclohexylsulfanyl-4-(methanesulfonamido)benzenesulfonamide (PubChem CID 19594489) has the molecular formula C13H20N2O4S3 and a molecular weight of 364.51 g/mol. Its IUPAC name is 3-cyclohexylsulfanyl-4-(methanesulfonamido)benzenesulfonamide.
| Compound Name | 3-cyclohexylsulfanyl-4-(methanesulfonamido)benzenesulfonamide |
|---|---|
| PubChem CID | 19594489 |
| Molecular Formula | C13H20N2O4S3 |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | 3-cyclohexylsulfanyl-4-(methanesulfonamido)benzenesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(S(N)(=O)=O)cc1SC1CCCCC1 |
| InChI | InChI=1S/C13H20N2O4S3/c1-21(16,17)15-12-8-7-11(22(14,18)19)9-13(12)20-10-5-3-2-4-6-10/h7-10,15H,2-6H2,1H3,(H2,14,18,19) |
| InChIKey | JNAMDJHCQMTARV-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |