C14H16N2O5S3 — CID 19594478
4-(methanesulfonamido)-3-(4-methoxyphenyl)sulfanylbenzenesulfonamide (PubChem CID 19594478) has the molecular formula C14H16N2O5S3 and a molecular weight of 388.49 g/mol. Its IUPAC name is 4-(methanesulfonamido)-3-(4-methoxyphenyl)sulfanylbenzenesulfonamide.
| Compound Name | 4-(methanesulfonamido)-3-(4-methoxyphenyl)sulfanylbenzenesulfonamide |
|---|---|
| PubChem CID | 19594478 |
| Molecular Formula | C14H16N2O5S3 |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.02 |
| IUPAC Name | 4-(methanesulfonamido)-3-(4-methoxyphenyl)sulfanylbenzenesulfonamide |
| SMILES | COc1ccc(Sc2cc(S(N)(=O)=O)ccc2NS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C14H16N2O5S3/c1-21-10-3-5-11(6-4-10)22-14-9-12(24(15,19)20)7-8-13(14)16-23(2,17)18/h3-9,16H,1-2H3,(H2,15,19,20) |
| InChIKey | RUQFLRWENLUJFP-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |