C11H16N2O2S2 — CID 112675204
2-amino-3-cyclopentylsulfanylbenzenesulfonamide (PubChem CID 112675204) has the molecular formula C11H16N2O2S2 and a molecular weight of 272.39 g/mol. Its IUPAC name is 2-amino-3-cyclopentylsulfanylbenzenesulfonamide.
| Compound Name | 2-amino-3-cyclopentylsulfanylbenzenesulfonamide |
|---|---|
| PubChem CID | 112675204 |
| Molecular Formula | C11H16N2O2S2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 2-amino-3-cyclopentylsulfanylbenzenesulfonamide |
| SMILES | Nc1c(SC2CCCC2)cccc1S(N)(=O)=O |
| InChI | InChI=1S/C11H16N2O2S2/c12-11-9(16-8-4-1-2-5-8)6-3-7-10(11)17(13,14)15/h3,6-8H,1-2,4-5,12H2,(H2,13,14,15) |
| InChIKey | SAFCIVSEQKALKC-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|