C14H21N3O2S — CID 115992914
3-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-2-aminobenzenesulfonamide (PubChem CID 115992914) has the molecular formula C14H21N3O2S and a molecular weight of 295.41 g/mol. Its IUPAC name is 3-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-2-aminobenzenesulfonamide.
| Compound Name | 3-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-2-aminobenzenesulfonamide |
|---|---|
| PubChem CID | 115992914 |
| Molecular Formula | C14H21N3O2S |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 3-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-2-aminobenzenesulfonamide |
| SMILES | Nc1c(N2CCC3CCCCC32)cccc1S(N)(=O)=O |
| InChI | InChI=1S/C14H21N3O2S/c15-14-12(6-3-7-13(14)20(16,18)19)17-9-8-10-4-1-2-5-11(10)17/h3,6-7,10-11H,1-2,4-5,8-9,15H2,(H2,16,18,19) |
| InChIKey | RMWNEXONNGXBTA-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|