C12H19N3O2S — CID 112674981
2-amino-3-(3,4-dimethylpyrrolidin-1-yl)benzenesulfonamide (PubChem CID 112674981) has the molecular formula C12H19N3O2S and a molecular weight of 269.37 g/mol. Its IUPAC name is 2-amino-3-(3,4-dimethylpyrrolidin-1-yl)benzenesulfonamide.
| Compound Name | 2-amino-3-(3,4-dimethylpyrrolidin-1-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 112674981 |
| Molecular Formula | C12H19N3O2S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 2-amino-3-(3,4-dimethylpyrrolidin-1-yl)benzenesulfonamide |
| SMILES | CC1CN(c2cccc(S(N)(=O)=O)c2N)CC1C |
| InChI | InChI=1S/C12H19N3O2S/c1-8-6-15(7-9(8)2)10-4-3-5-11(12(10)13)18(14,16)17/h3-5,8-9H,6-7,13H2,1-2H3,(H2,14,16,17) |
| InChIKey | NHIIQLGFVIQXMZ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|