About 2-amino-3-(3,4-dimethylpyrrolidin-1-yl)benzenesulfonamide
2-amino-3-(3,4-dimethylpyrrolidin-1-yl)benzenesulfonamide (PubChem CID 112674981) has the molecular formula C12H19N3O2S
and a molecular weight of 269.37 g/mol. Its IUPAC name is 2-amino-3-(3,4-dimethylpyrrolidin-1-yl)benzenesulfonamide.
Molecular Properties
| Compound Name | 2-amino-3-(3,4-dimethylpyrrolidin-1-yl)benzenesulfonamide |
| PubChem CID | 112674981 |
| Molecular Formula | C12H19N3O2S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 2-amino-3-(3,4-dimethylpyrrolidin-1-yl)benzenesulfonamide |
| SMILES | CC1CN(c2cccc(S(N)(=O)=O)c2N)CC1C |
| InChI | InChI=1S/C12H19N3O2S/c1-8-6-15(7-9(8)2)10-4-3-5-11(12(10)13)18(14,16)17/h3-5,8-9H,6-7,13H2,1-2H3,(H2,14,16,17) |
| InChIKey | NHIIQLGFVIQXMZ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-3-(3,4-dimethylpyrrolidin-1-yl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-(3,4-dimethylpyrrolidin-1-yl)benzenesulfonamide?
The IUPAC name of 2-amino-3-(3,4-dimethylpyrrolidin-1-yl)benzenesulfonamide (CID 112674981) is 2-amino-3-(3,4-dimethylpyrrolidin-1-yl)benzenesulfonamide.
What is the SMILES notation for 2-amino-3-(3,4-dimethylpyrrolidin-1-yl)benzenesulfonamide?
The canonical SMILES for 2-amino-3-(3,4-dimethylpyrrolidin-1-yl)benzenesulfonamide is CC1CN(c2cccc(S(N)(=O)=O)c2N)CC1C.
What is the InChIKey of 2-amino-3-(3,4-dimethylpyrrolidin-1-yl)benzenesulfonamide?
The InChIKey is NHIIQLGFVIQXMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O2S/c1-8-6-15(7-9(8)2)10-4-3-5-11(12(10)13)18(14,16)17/h3-5,8-9H,6-7,13H2,1-2H3,(H2,14,16,17).
What are the key properties of 2-amino-3-(3,4-dimethylpyrrolidin-1-yl)benzenesulfonamide?
2-amino-3-(3,4-dimethylpyrrolidin-1-yl)benzenesulfonamide has a molecular weight of 269.37 g/mol, XLogP of 1.01, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-(3,4-dimethylpyrrolidin-1-yl)benzenesulfonamide is sourced from PubChem (CID 112674981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).