C12H19N3O3S — CID 104957789
2-amino-3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]benzenesulfonamide (PubChem CID 104957789) has the molecular formula C12H19N3O3S and a molecular weight of 285.37 g/mol. Its IUPAC name is 2-amino-3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]benzenesulfonamide.
| Compound Name | 2-amino-3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 104957789 |
| Molecular Formula | C12H19N3O3S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 2-amino-3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]benzenesulfonamide |
| SMILES | C[C@@H]1CN(c2cccc(S(N)(=O)=O)c2N)C[C@H](C)O1 |
| InChI | InChI=1S/C12H19N3O3S/c1-8-6-15(7-9(2)18-8)10-4-3-5-11(12(10)13)19(14,16)17/h3-5,8-9H,6-7,13H2,1-2H3,(H2,14,16,17)/t8-,9+ |
| InChIKey | SUCIJJKVXXSGMT-DTORHVGOSA-N |
| XLogP | 0.53 |
| TPSA | 98.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|