C15H17N3O2S — CID 115992229
2-amino-3-(3,4-dihydro-1H-isoquinolin-2-yl)benzenesulfonamide (PubChem CID 115992229) has the molecular formula C15H17N3O2S and a molecular weight of 303.39 g/mol. Its IUPAC name is 2-amino-3-(3,4-dihydro-1H-isoquinolin-2-yl)benzenesulfonamide.
| Compound Name | 2-amino-3-(3,4-dihydro-1H-isoquinolin-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 115992229 |
| Molecular Formula | C15H17N3O2S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 2-amino-3-(3,4-dihydro-1H-isoquinolin-2-yl)benzenesulfonamide |
| SMILES | Nc1c(N2CCc3ccccc3C2)cccc1S(N)(=O)=O |
| InChI | InChI=1S/C15H17N3O2S/c16-15-13(6-3-7-14(15)21(17,19)20)18-9-8-11-4-1-2-5-12(11)10-18/h1-7H,8-10,16H2,(H2,17,19,20) |
| InChIKey | CPYXJVJXMBTXSR-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|