C14H14FN3O2S — CID 103494011
2-amino-3-(6-fluoro-2,3-dihydroindol-1-yl)benzenesulfonamide (PubChem CID 103494011) has the molecular formula C14H14FN3O2S and a molecular weight of 307.35 g/mol. Its IUPAC name is 2-amino-3-(6-fluoro-2,3-dihydroindol-1-yl)benzenesulfonamide.
| Compound Name | 2-amino-3-(6-fluoro-2,3-dihydroindol-1-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 103494011 |
| Molecular Formula | C14H14FN3O2S |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 2-amino-3-(6-fluoro-2,3-dihydroindol-1-yl)benzenesulfonamide |
| SMILES | Nc1c(N2CCc3ccc(F)cc32)cccc1S(N)(=O)=O |
| InChI | InChI=1S/C14H14FN3O2S/c15-10-5-4-9-6-7-18(12(9)8-10)11-2-1-3-13(14(11)16)21(17,19)20/h1-5,8H,6-7,16H2,(H2,17,19,20) |
| InChIKey | RHJUJTJTEBMNDN-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|