C14H12F2N2 — CID 113325091
2-(2,3-dihydroindol-1-yl)-4,6-difluoroaniline (PubChem CID 113325091) has the molecular formula C14H12F2N2 and a molecular weight of 246.26 g/mol. Its IUPAC name is 2-(2,3-dihydroindol-1-yl)-4,6-difluoroaniline.
| Compound Name | 2-(2,3-dihydroindol-1-yl)-4,6-difluoroaniline |
|---|---|
| PubChem CID | 113325091 |
| Molecular Formula | C14H12F2N2 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 2-(2,3-dihydroindol-1-yl)-4,6-difluoroaniline |
| SMILES | Nc1c(F)cc(F)cc1N1CCc2ccccc21 |
| InChI | InChI=1S/C14H12F2N2/c15-10-7-11(16)14(17)13(8-10)18-6-5-9-3-1-2-4-12(9)18/h1-4,7-8H,5-6,17H2 |
| InChIKey | BHAKDOWQXCUVLA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|