C15H13ClFN — CID 114065374
1-[2-(chloromethyl)-3-fluorophenyl]-2,3-dihydroindole (PubChem CID 114065374) has the molecular formula C15H13ClFN and a molecular weight of 261.73 g/mol. Its IUPAC name is 1-[2-(chloromethyl)-3-fluorophenyl]-2,3-dihydroindole.
| Compound Name | 1-[2-(chloromethyl)-3-fluorophenyl]-2,3-dihydroindole |
|---|---|
| PubChem CID | 114065374 |
| Molecular Formula | C15H13ClFN |
| Molecular Weight | 261.73 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 1-[2-(chloromethyl)-3-fluorophenyl]-2,3-dihydroindole |
| SMILES | Fc1cccc(N2CCc3ccccc32)c1CCl |
| InChI | InChI=1S/C15H13ClFN/c16-10-12-13(17)5-3-7-15(12)18-9-8-11-4-1-2-6-14(11)18/h1-7H,8-10H2 |
| InChIKey | DVGDHLMXMXAFRN-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.73 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|