C16H13ClN2 — CID 114063521
5-(chloromethyl)-2-(2,3-dihydroindol-1-yl)benzonitrile (PubChem CID 114063521) has the molecular formula C16H13ClN2 and a molecular weight of 268.75 g/mol. Its IUPAC name is 5-(chloromethyl)-2-(2,3-dihydroindol-1-yl)benzonitrile.
| Compound Name | 5-(chloromethyl)-2-(2,3-dihydroindol-1-yl)benzonitrile |
|---|---|
| PubChem CID | 114063521 |
| Molecular Formula | C16H13ClN2 |
| Molecular Weight | 268.75 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 5-(chloromethyl)-2-(2,3-dihydroindol-1-yl)benzonitrile |
| SMILES | N#Cc1cc(CCl)ccc1N1CCc2ccccc21 |
| InChI | InChI=1S/C16H13ClN2/c17-10-12-5-6-16(14(9-12)11-18)19-8-7-13-3-1-2-4-15(13)19/h1-6,9H,7-8,10H2 |
| InChIKey | VUVIBHZAFVPAEC-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.75 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|