C15H10BrFN2 — CID 107533105
2-bromo-4-(2,3-dihydroindol-1-yl)-3-fluorobenzonitrile (PubChem CID 107533105) has the molecular formula C15H10BrFN2 and a molecular weight of 317.16 g/mol. Its IUPAC name is 2-bromo-4-(2,3-dihydroindol-1-yl)-3-fluorobenzonitrile.
| Compound Name | 2-bromo-4-(2,3-dihydroindol-1-yl)-3-fluorobenzonitrile |
|---|---|
| PubChem CID | 107533105 |
| Molecular Formula | C15H10BrFN2 |
| Molecular Weight | 317.16 g/mol |
| Exact Mass | 316.00 |
| IUPAC Name | 2-bromo-4-(2,3-dihydroindol-1-yl)-3-fluorobenzonitrile |
| SMILES | N#Cc1ccc(N2CCc3ccccc32)c(F)c1Br |
| InChI | InChI=1S/C15H10BrFN2/c16-14-11(9-18)5-6-13(15(14)17)19-8-7-10-3-1-2-4-12(10)19/h1-6H,7-8H2 |
| InChIKey | JJYFVZGFWWFUDA-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.16 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |