C14H16BrFN2 — CID 107533586
2-bromo-4-(2,4-dimethylpiperidin-1-yl)-3-fluorobenzonitrile (PubChem CID 107533586) has the molecular formula C14H16BrFN2 and a molecular weight of 311.20 g/mol. Its IUPAC name is 2-bromo-4-(2,4-dimethylpiperidin-1-yl)-3-fluorobenzonitrile.
| Compound Name | 2-bromo-4-(2,4-dimethylpiperidin-1-yl)-3-fluorobenzonitrile |
|---|---|
| PubChem CID | 107533586 |
| Molecular Formula | C14H16BrFN2 |
| Molecular Weight | 311.20 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | 2-bromo-4-(2,4-dimethylpiperidin-1-yl)-3-fluorobenzonitrile |
| SMILES | CC1CCN(c2ccc(C#N)c(Br)c2F)C(C)C1 |
| InChI | InChI=1S/C14H16BrFN2/c1-9-5-6-18(10(2)7-9)12-4-3-11(8-17)13(15)14(12)16/h3-4,9-10H,5-7H2,1-2H3 |
| InChIKey | FVWLXVDYEKKQMY-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.20 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |