About 2-bromo-4-(2,5-dimethylmorpholin-4-yl)-3-fluorobenzonitrile
2-bromo-4-(2,5-dimethylmorpholin-4-yl)-3-fluorobenzonitrile (PubChem CID 107533240) has the molecular formula C13H14BrFN2O
and a molecular weight of 313.17 g/mol. Its IUPAC name is 2-bromo-4-(2,5-dimethylmorpholin-4-yl)-3-fluorobenzonitrile.
Molecular Properties
| Compound Name | 2-bromo-4-(2,5-dimethylmorpholin-4-yl)-3-fluorobenzonitrile |
| PubChem CID | 107533240 |
| Molecular Formula | C13H14BrFN2O |
| Molecular Weight | 313.17 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | 2-bromo-4-(2,5-dimethylmorpholin-4-yl)-3-fluorobenzonitrile |
| SMILES | CC1CN(c2ccc(C#N)c(Br)c2F)C(C)CO1 |
| InChI | InChI=1S/C13H14BrFN2O/c1-8-7-18-9(2)6-17(8)11-4-3-10(5-16)12(14)13(11)15/h3-4,8-9H,6-7H2,1-2H3 |
| InChIKey | RBGNMBZNGLJINZ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.17 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-bromo-4-(2,5-dimethylmorpholin-4-yl)-3-fluorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-4-(2,5-dimethylmorpholin-4-yl)-3-fluorobenzonitrile?
The IUPAC name of 2-bromo-4-(2,5-dimethylmorpholin-4-yl)-3-fluorobenzonitrile (CID 107533240) is 2-bromo-4-(2,5-dimethylmorpholin-4-yl)-3-fluorobenzonitrile.
What is the SMILES notation for 2-bromo-4-(2,5-dimethylmorpholin-4-yl)-3-fluorobenzonitrile?
The canonical SMILES for 2-bromo-4-(2,5-dimethylmorpholin-4-yl)-3-fluorobenzonitrile is CC1CN(c2ccc(C#N)c(Br)c2F)C(C)CO1.
What is the InChIKey of 2-bromo-4-(2,5-dimethylmorpholin-4-yl)-3-fluorobenzonitrile?
The InChIKey is RBGNMBZNGLJINZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14BrFN2O/c1-8-7-18-9(2)6-17(8)11-4-3-10(5-16)12(14)13(11)15/h3-4,8-9H,6-7H2,1-2H3.
What are the key properties of 2-bromo-4-(2,5-dimethylmorpholin-4-yl)-3-fluorobenzonitrile?
2-bromo-4-(2,5-dimethylmorpholin-4-yl)-3-fluorobenzonitrile has a molecular weight of 313.17 g/mol, XLogP of 3.07, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4-(2,5-dimethylmorpholin-4-yl)-3-fluorobenzonitrile is sourced from PubChem (CID 107533240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).