C13H14F2N2O — CID 81283111
4-(2,5-dimethylmorpholin-4-yl)-3,5-difluorobenzonitrile (PubChem CID 81283111) has the molecular formula C13H14F2N2O and a molecular weight of 252.26 g/mol. Its IUPAC name is 4-(2,5-dimethylmorpholin-4-yl)-3,5-difluorobenzonitrile.
| Compound Name | 4-(2,5-dimethylmorpholin-4-yl)-3,5-difluorobenzonitrile |
|---|---|
| PubChem CID | 81283111 |
| Molecular Formula | C13H14F2N2O |
| Molecular Weight | 252.26 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 4-(2,5-dimethylmorpholin-4-yl)-3,5-difluorobenzonitrile |
| SMILES | CC1CN(c2c(F)cc(C#N)cc2F)C(C)CO1 |
| InChI | InChI=1S/C13H14F2N2O/c1-8-7-18-9(2)6-17(8)13-11(14)3-10(5-16)4-12(13)15/h3-4,8-9H,6-7H2,1-2H3 |
| InChIKey | LJFSVSREGZOBER-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.26 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |