C12H13F2N3 — CID 104976145
3,5-difluoro-4-[(3R)-3-methylpiperazin-1-yl]benzonitrile (PubChem CID 104976145) has the molecular formula C12H13F2N3 and a molecular weight of 237.25 g/mol. Its IUPAC name is 3,5-difluoro-4-[(3R)-3-methylpiperazin-1-yl]benzonitrile.
| Compound Name | 3,5-difluoro-4-[(3R)-3-methylpiperazin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 104976145 |
| Molecular Formula | C12H13F2N3 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | 3,5-difluoro-4-[(3R)-3-methylpiperazin-1-yl]benzonitrile |
| SMILES | C[C@@H]1CN(c2c(F)cc(C#N)cc2F)CCN1 |
| InChI | InChI=1S/C12H13F2N3/c1-8-7-17(3-2-16-8)12-10(13)4-9(6-15)5-11(12)14/h4-5,8,16H,2-3,7H2,1H3/t8-/m1/s1 |
| InChIKey | MNKAEWAELOVUMG-MRVPVSSYSA-N |
| XLogP | 1.63 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |