4-(4-cyano-2,6-difluorophenyl)morpholine-2-carboxylic acid

C12H10F2N2O3 — CID 81293789

IUPAC4-(4-cyano-2,6-difluorophenyl)morpholine-2-carboxylic acid
SMILESN#Cc1cc(F)c(N2CCOC(C(=O)O)C2)c(F)c1
InChIInChI=1S/C12H10F2N2O3/c13-8-3-7(5-15)4-9(14)11(8)16-1-2-19-10(6-16)12(17)18/h3-4,10H,1-2,6H2,(H,17,18)
InChIKeyINIOIRBCSJRPRU-UHFFFAOYSA-N
MW268.22 g/mol
LogP1.13
Rot. Bonds2

About 4-(4-cyano-2,6-difluorophenyl)morpholine-2-carboxylic acid

4-(4-cyano-2,6-difluorophenyl)morpholine-2-carboxylic acid (PubChem CID 81293789) has the molecular formula C12H10F2N2O3 and a molecular weight of 268.22 g/mol. Its IUPAC name is 4-(4-cyano-2,6-difluorophenyl)morpholine-2-carboxylic acid.

Molecular Properties

Compound Name4-(4-cyano-2,6-difluorophenyl)morpholine-2-carboxylic acid
PubChem CID81293789
Molecular FormulaC12H10F2N2O3
Molecular Weight268.22 g/mol
Exact Mass268.07
IUPAC Name4-(4-cyano-2,6-difluorophenyl)morpholine-2-carboxylic acid
SMILESN#Cc1cc(F)c(N2CCOC(C(=O)O)C2)c(F)c1
InChIInChI=1S/C12H10F2N2O3/c13-8-3-7(5-15)4-9(14)11(8)16-1-2-19-10(6-16)12(17)18/h3-4,10H,1-2,6H2,(H,17,18)
InChIKeyINIOIRBCSJRPRU-UHFFFAOYSA-N
XLogP1.13
TPSA73.56 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500268.22
LogP ≤ 51.13
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 4-(4-cyano-2,6-difluorophenyl)morpholine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(4-cyano-2,6-difluorophenyl)morpholine-2-carboxylic acid?
The IUPAC name of 4-(4-cyano-2,6-difluorophenyl)morpholine-2-carboxylic acid (CID 81293789) is 4-(4-cyano-2,6-difluorophenyl)morpholine-2-carboxylic acid.
What is the SMILES notation for 4-(4-cyano-2,6-difluorophenyl)morpholine-2-carboxylic acid?
The canonical SMILES for 4-(4-cyano-2,6-difluorophenyl)morpholine-2-carboxylic acid is N#Cc1cc(F)c(N2CCOC(C(=O)O)C2)c(F)c1.
What is the InChIKey of 4-(4-cyano-2,6-difluorophenyl)morpholine-2-carboxylic acid?
The InChIKey is INIOIRBCSJRPRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10F2N2O3/c13-8-3-7(5-15)4-9(14)11(8)16-1-2-19-10(6-16)12(17)18/h3-4,10H,1-2,6H2,(H,17,18).
What are the key properties of 4-(4-cyano-2,6-difluorophenyl)morpholine-2-carboxylic acid?
4-(4-cyano-2,6-difluorophenyl)morpholine-2-carboxylic acid has a molecular weight of 268.22 g/mol, XLogP of 1.13, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-cyano-2,6-difluorophenyl)morpholine-2-carboxylic acid is sourced from PubChem (CID 81293789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).