C16H19F2N3 — CID 78949602
3,5-difluoro-4-(3-piperidin-1-ylpyrrolidin-1-yl)benzonitrile (PubChem CID 78949602) has the molecular formula C16H19F2N3 and a molecular weight of 291.34 g/mol. Its IUPAC name is 3,5-difluoro-4-(3-piperidin-1-ylpyrrolidin-1-yl)benzonitrile.
| Compound Name | 3,5-difluoro-4-(3-piperidin-1-ylpyrrolidin-1-yl)benzonitrile |
|---|---|
| PubChem CID | 78949602 |
| Molecular Formula | C16H19F2N3 |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 3,5-difluoro-4-(3-piperidin-1-ylpyrrolidin-1-yl)benzonitrile |
| SMILES | N#Cc1cc(F)c(N2CCC(N3CCCCC3)C2)c(F)c1 |
| InChI | InChI=1S/C16H19F2N3/c17-14-8-12(10-19)9-15(18)16(14)21-7-4-13(11-21)20-5-2-1-3-6-20/h8-9,13H,1-7,11H2 |
| InChIKey | IOYFUEUJJLFZGM-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |