C15H19BrF2N2 — CID 107083312
1-[4-(bromomethyl)-2,6-difluorophenyl]-3-pyrrolidin-1-ylpyrrolidine (PubChem CID 107083312) has the molecular formula C15H19BrF2N2 and a molecular weight of 345.23 g/mol. Its IUPAC name is 1-[4-(bromomethyl)-2,6-difluorophenyl]-3-pyrrolidin-1-ylpyrrolidine.
| Compound Name | 1-[4-(bromomethyl)-2,6-difluorophenyl]-3-pyrrolidin-1-ylpyrrolidine |
|---|---|
| PubChem CID | 107083312 |
| Molecular Formula | C15H19BrF2N2 |
| Molecular Weight | 345.23 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 1-[4-(bromomethyl)-2,6-difluorophenyl]-3-pyrrolidin-1-ylpyrrolidine |
| SMILES | Fc1cc(CBr)cc(F)c1N1CCC(N2CCCC2)C1 |
| InChI | InChI=1S/C15H19BrF2N2/c16-9-11-7-13(17)15(14(18)8-11)20-6-3-12(10-20)19-4-1-2-5-19/h7-8,12H,1-6,9-10H2 |
| InChIKey | TUTGAZLIRLWCNP-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.23 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|