C11H12BrF2N — CID 107078854
1-[4-(bromomethyl)-2,6-difluorophenyl]pyrrolidine (PubChem CID 107078854) has the molecular formula C11H12BrF2N and a molecular weight of 276.12 g/mol. Its IUPAC name is 1-[4-(bromomethyl)-2,6-difluorophenyl]pyrrolidine.
| Compound Name | 1-[4-(bromomethyl)-2,6-difluorophenyl]pyrrolidine |
|---|---|
| PubChem CID | 107078854 |
| Molecular Formula | C11H12BrF2N |
| Molecular Weight | 276.12 g/mol |
| Exact Mass | 275.01 |
| IUPAC Name | 1-[4-(bromomethyl)-2,6-difluorophenyl]pyrrolidine |
| SMILES | Fc1cc(CBr)cc(F)c1N1CCCC1 |
| InChI | InChI=1S/C11H12BrF2N/c12-7-8-5-9(13)11(10(14)6-8)15-3-1-2-4-15/h5-6H,1-4,7H2 |
| InChIKey | MPLSOHOZULBZCY-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.12 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|