C16H22BrF2N — CID 107083971
1-[4-(bromomethyl)-2,6-difluorophenyl]-4-propylazepane (PubChem CID 107083971) has the molecular formula C16H22BrF2N and a molecular weight of 346.26 g/mol. Its IUPAC name is 1-[4-(bromomethyl)-2,6-difluorophenyl]-4-propylazepane.
| Compound Name | 1-[4-(bromomethyl)-2,6-difluorophenyl]-4-propylazepane |
|---|---|
| PubChem CID | 107083971 |
| Molecular Formula | C16H22BrF2N |
| Molecular Weight | 346.26 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 1-[4-(bromomethyl)-2,6-difluorophenyl]-4-propylazepane |
| SMILES | CCCC1CCCN(c2c(F)cc(CBr)cc2F)CC1 |
| InChI | InChI=1S/C16H22BrF2N/c1-2-4-12-5-3-7-20(8-6-12)16-14(18)9-13(11-17)10-15(16)19/h9-10,12H,2-8,11H2,1H3 |
| InChIKey | MKHBDQMMCLCWFR-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.26 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|