C15H21BrF2N2 — CID 107081713
1-[1-[4-(bromomethyl)-2,6-difluorophenyl]piperidin-4-yl]-N,N-dimethylmethanamine (PubChem CID 107081713) has the molecular formula C15H21BrF2N2 and a molecular weight of 347.25 g/mol. Its IUPAC name is 1-[1-[4-(bromomethyl)-2,6-difluorophenyl]piperidin-4-yl]-N,N-dimethylmethanamine.
| Compound Name | 1-[1-[4-(bromomethyl)-2,6-difluorophenyl]piperidin-4-yl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 107081713 |
| Molecular Formula | C15H21BrF2N2 |
| Molecular Weight | 347.25 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 1-[1-[4-(bromomethyl)-2,6-difluorophenyl]piperidin-4-yl]-N,N-dimethylmethanamine |
| SMILES | CN(C)CC1CCN(c2c(F)cc(CBr)cc2F)CC1 |
| InChI | InChI=1S/C15H21BrF2N2/c1-19(2)10-11-3-5-20(6-4-11)15-13(17)7-12(9-16)8-14(15)18/h7-8,11H,3-6,9-10H2,1-2H3 |
| InChIKey | COFHLQJEDNHWPJ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.25 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|